Products 1346600-23-4
CAS 1346600-23-4 appears in our catalog under these names: 4-Amino-5-chloro-2-ethoxybenzoic Acid-d5, 4–Amino–5–chloro–2–ethoxybenzoic Acid–d5. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
4-amino-5-chloro-2-(1,1,2,2,2-pentadeuterioethoxy)benzoic acid (CAS 1346600-23-4) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 220.66 g/mol. IUPAC name: 4-amino-5-chloro-2-(1,1,2,2,2-pentadeuterioethoxy)benzoic acid. InChIKey: XWGYOMHQGQZRLC-ZBJDZAJPSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 220.66 g/mol |
| IUPAC name | 4-amino-5-chloro-2-(1,1,2,2,2-pentadeuterioethoxy)benzoic acid |
| InChIKey | XWGYOMHQGQZRLC-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC(=C(C=C1C(=O)O)Cl)N |
Computed by PubChem (NCBI)