cas: 5434-21-9 — see every product listed under this CAS number, including other names
4-Aminophthalic acid 95% (CAS 5434-21-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A231534-1g |
| cas | 5434-21-9 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 470.50 Pln | |
| Ambeed | 500g | 1460.62 Pln | |
| Ambeed | 1000g | 2445.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A231534 |
4-aminophthalic acid (CAS 5434-21-9) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 4-aminophthalic acid. InChIKey: OXSANYRLJHSQEP-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-aminophthalic acid |
| InChIKey | OXSANYRLJHSQEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)