Products 33890-03-8
CAS 33890-03-8 appears in our catalog under these names: 4-Aminobenzene-1,3-dicarboxylic acid, 97%, 4–Aminobenzene–1,3–dicarboxylic acid, 4-Aminoisophthalic acid 98%, 4-Aminoisophthalic acid, 98%, 98%, 4-Aminoisophthalic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-aminobenzene-1,3-dicarboxylic acid (CAS 33890-03-8) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 4-aminobenzene-1,3-dicarboxylic acid. InChIKey: BDBLLWHZWCBDAR-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-aminobenzene-1,3-dicarboxylic acid |
| InChIKey | BDBLLWHZWCBDAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)N |
Computed by PubChem (NCBI)