CAS 32996-27-3 appears in our catalog under these names: 5-Methyl-6-nitro-1,3-benzodioxole, 95%, 5-Methyl-6-nitrobenzo(d)(1,3)dioxole, 97%, 5-Methyl-6-nitrobenzo[d][1,3]dioxole, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-methyl-6-nitro-1,3-benzodioxole (CAS 32996-27-3) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 5-methyl-6-nitro-1,3-benzodioxole. InChIKey: HSJXVJRZFPZLSP-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 5-methyl-6-nitro-1,3-benzodioxole |
| InChIKey | HSJXVJRZFPZLSP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1[N+](=O)[O-])OCO2 |
Computed by PubChem (NCBI)