CAS 5027-65-6 appears in our catalog under these names: 5-(Methoxycarbonyl)nicotinic acid, 98%, 5-(methoxycarbonyl)pyridine-3-carboxylic acid, 5-(Methoxycarbonyl),nicotinic acid, 98%, 98%, 5-(METHOXYCARBONYL)NICOTINIC ACID, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 25g, 10g, 5g, 2,5g, 100mg.
5-methoxycarbonylpyridine-3-carboxylic acid (CAS 5027-65-6) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 5-methoxycarbonylpyridine-3-carboxylic acid. InChIKey: GUXKBDHITFXEJG-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 5-methoxycarbonylpyridine-3-carboxylic acid |
| InChIKey | GUXKBDHITFXEJG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)