Products 1975-50-4
CAS 1975-50-4 appears in our catalog under these names: 2-Methyl-3-nitrobenzoic acid, 98%, Lenalidomide Impurity 26, 2–Methyl–3–nitrobenzoic Acid, 2-Methyl-3-nitrobenzoic acid, 2-Methyl-3-nitrobenzoic Acid, >98.0%(T). Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, TCI. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, on request, 250g, 2kg.
2-methyl-3-nitrobenzoic acid (CAS 1975-50-4) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 2-methyl-3-nitrobenzoic acid. InChIKey: YPQAFWHSMWWPLX-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-methyl-3-nitrobenzoic acid |
| InChIKey | YPQAFWHSMWWPLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)