CAS 2031285-14-8 is the registry number for (2E)-3-(5-carbamoylfuran-2-yl)prop-2-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-3-(5-carbamoylfuran-2-yl)prop-2-enoic acid (CAS 2031285-14-8) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: (E)-3-(5-carbamoylfuran-2-yl)prop-2-enoic acid. InChIKey: ZNHUNKLEVGHOCV-DUXPYHPUSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (E)-3-(5-carbamoylfuran-2-yl)prop-2-enoic acid |
| InChIKey | ZNHUNKLEVGHOCV-DUXPYHPUSA-N |
| SMILES | C1=C(OC(=C1)C(=O)N)/C=C/C(=O)O |
Computed by PubChem (NCBI)