cas: 5001-94-5 — see every product listed under this CAS number, including other names
4-BIPHENYL-3'-CHLORO-ACETIC ACID, 97% (CAS 5001-94-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305886-250MG |
| cas | 5001-94-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 5948.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[4-(3-chlorophenyl)phenyl]acetic acid (CAS 5001-94-5) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 2-[4-(3-chlorophenyl)phenyl]acetic acid. InChIKey: OFYYGQTZEFSDIM-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 2-[4-(3-chlorophenyl)phenyl]acetic acid |
| InChIKey | OFYYGQTZEFSDIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)