Products 5001-94-5
CAS 5001-94-5 appears in our catalog under these names: [4-(3-Chlorophenyl)phenyl]acetic acid, 98%, 2-(3'-Chloro-[1,1'-biphenyl]-4-yl)acetic acid 98%, [4-(3-Chlorophenyl)phenyl]acetic acid, 98%, 98%, 4-BIPHENYL-3'-CHLORO-ACETIC ACID, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-[4-(3-chlorophenyl)phenyl]acetic acid (CAS 5001-94-5) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 2-[4-(3-chlorophenyl)phenyl]acetic acid. InChIKey: OFYYGQTZEFSDIM-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 2-[4-(3-chlorophenyl)phenyl]acetic acid |
| InChIKey | OFYYGQTZEFSDIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(3'-Chloro-[1,1'-biphenyl]-4-yl)acetic acid, [4-(3-Chlorophenyl)phenyl]acetic acid, 4-Biphenyl-3'-chloro-acetic acid, 2-[4-(3-chlorophenyl)phenyl]acetic Acid, 2-(3'-Chloro-[1,1'-biphenyl]-4-yl)aceticacid, 4-Biphenyl-3'-chloro-aceticacid, 3'-Chloro-biphenyl-4-acetic acid, (3'-Chlorobiphenyl-4-yl)acetic acid, 3'-Chloro[1,1'-biphenyl]-4-acetic acid, (3'-Chloro[1,1'-biphenyl]-4-yl)acetic acid