4-BROMO-6-PHENYLDIBENZO[B,D]FURAN, 97%
cas: 1010068-84-4 — see every product listed under this CAS number, including other names
4-BROMO-6-PHENYLDIBENZO[B,D]FURAN, 97% (CAS 1010068-84-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F814975-1G |
| cas | 1010068-84-4 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 414.46 Pln | |
| Fluorochem | 25g | 1419.31 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 459.38 Pln | |
| Ambeed | 25g | 1505.12 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 453.20 Pln | |
| BLDpharm | 25g | 1475.06 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 256.40 Pln | |
| Chemat | 25g | 693.20 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-bromo-6-phenyldibenzofuran (CAS 1010068-84-4) is a chemical compound with the molecular formula C18H11BrO and a molecular weight of 323.2 g/mol. IUPAC name: 4-bromo-6-phenyldibenzofuran. InChIKey: MPSDYLBAJCSIMR-UHFFFAOYSA-N.
| Molecular formula | C18H11BrO |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 4-bromo-6-phenyldibenzofuran |
| InChIKey | MPSDYLBAJCSIMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2OC4=C3C=CC=C4Br |
Computed by PubChem (NCBI)