4-Benzhydrylaniline, 97%
cas: 603-38-3 — see every product listed under this CAS number, including other names
4-Benzhydrylaniline, 97% (CAS 603-38-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A240570-100mg |
| cas | 603-38-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 770.88 Pln | |
| Ambeed | 250mg | 1210.31 Pln | |
| Ambeed | 1g | 3257.31 Pln | |
| BLDpharm | 100mg | 753.09 Pln | |
| BLDpharm | 250mg | 1180.72 Pln | |
| BLDpharm | 1g | 3191.12 Pln | |
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 2099.60 Pln | |
| Fluorochem | 100mg | 732.05 Pln | |
| Fluorochem | 250mg | 1143.37 Pln | |
| Fluorochem | 1g | 3080.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-benzhydrylaniline (CAS 603-38-3) is a chemical compound with the molecular formula C19H17N and a molecular weight of 259.3 g/mol. IUPAC name: 4-benzhydrylaniline. InChIKey: IVKMZPOWNVXFFH-UHFFFAOYSA-N.
| Molecular formula | C19H17N |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 4-benzhydrylaniline |
| InChIKey | IVKMZPOWNVXFFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)