cas: 1993479-31-4 — see every product listed under this CAS number, including other names
4-Benzyloxy-2,6-difluorobenzoic acid methyl ester (CAS 1993479-31-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631564-1G |
| cas | 1993479-31-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 6058.30 Pln | |
| Fluorochem | 5g | 18054.08 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2,6-difluoro-4-phenylmethoxybenzoate (CAS 1993479-31-4) is a chemical compound with the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. IUPAC name: methyl 2,6-difluoro-4-phenylmethoxybenzoate. InChIKey: FIWMTMDFAZWBQJ-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O3 |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | methyl 2,6-difluoro-4-phenylmethoxybenzoate |
| InChIKey | FIWMTMDFAZWBQJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)