4-Benzyloxyphenylboronic acid, 98%
cas: 146631-00-7 — see every product listed under this CAS number, including other names
4-Benzyloxyphenylboronic acid, 98% (CAS 146631-00-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A113646-1g |
| cas | 146631-00-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 159.00 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 576.19 Pln | |
| Ambeed | 500g | 2584.25 Pln | |
| Fluorochem | 5g | 117.68 Pln | |
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 211.40 Pln | |
| Fluorochem | 50g | 357.18 Pln | |
| Fluorochem | 100g | 591.48 Pln | |
| Fluorochem | 500g | 2653.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4-phenylmethoxyphenyl)boronic acid (CAS 146631-00-7) is a chemical compound with the molecular formula C13H13BO3 and a molecular weight of 228.05 g/mol. IUPAC name: (4-phenylmethoxyphenyl)boronic acid. InChIKey: DMJHEIDWSIAXCS-UHFFFAOYSA-N.
| Molecular formula | C13H13BO3 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | (4-phenylmethoxyphenyl)boronic acid |
| InChIKey | DMJHEIDWSIAXCS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Benzyloxy-phenylboronic acid, 4-Benzyloxyphenylboronic acid, 4-Benzyloxybenzeneboronic Acid, (4-(Benzyloxy)phenyl)boronic acid, 4-(Benzyloxy)phenylboronic acid, [4-(benzyloxy)phenyl]boronic acid, (4-phenylmethoxyphenyl)boronic Acid, (4-benzyloxyphenyl)boronic acid, Boronic acid, [4-(phenylmethoxy)phenyl]-, 4-benzyloxy benzene boronic acid