cas: 855749-57-4 — see every product listed under this CAS number, including other names
4-Bromo-2,5-dimethoxy-benzoic acid methyl ester, ≥95%, ≥95% (CAS 855749-57-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K73E-1g |
| cas | 855749-57-4 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2205.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-2,5-dimethoxybenzoate (CAS 855749-57-4) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: methyl 4-bromo-2,5-dimethoxybenzoate. InChIKey: HHMGSRZYKUZJSU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | methyl 4-bromo-2,5-dimethoxybenzoate |
| InChIKey | HHMGSRZYKUZJSU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)OC)Br |
Computed by PubChem (NCBI)