cas: 1070879-60-5 — see every product listed under this CAS number, including other names
4-Bromo-2,6,8-trimethylquinoline (CAS 1070879-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F955652-100MG |
| cas | 1070879-60-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 3361.33 Pln | |
| Fluorochem | 5g | 12571.63 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-2,6,8-trimethylquinoline (CAS 1070879-60-5) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 4-bromo-2,6,8-trimethylquinoline. InChIKey: ZLLFZRRHKAPRNV-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 4-bromo-2,6,8-trimethylquinoline |
| InChIKey | ZLLFZRRHKAPRNV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C)Br)C |
Computed by PubChem (NCBI)