cas: 1160561-24-9 — see every product listed under this CAS number, including other names
4-Bromo-2,6-dimethylphenylboronic acid, 98% (CAS 1160561-24-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628010-250MG |
| cas | 1160561-24-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 633.13 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-bromo-2,6-dimethylphenyl)boronic acid (CAS 1160561-24-9) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (4-bromo-2,6-dimethylphenyl)boronic acid. InChIKey: OGYKUMRPICACAC-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (4-bromo-2,6-dimethylphenyl)boronic acid |
| InChIKey | OGYKUMRPICACAC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)Br)C)(O)O |
Computed by PubChem (NCBI)