cas: 893420-19-4 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-N,N-dimethylbenzamide 98% (CAS 893420-19-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A312314-250mg |
| cas | 893420-19-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1037.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A312314 |
4-bromo-2-chloro-N,N-dimethylbenzamide (CAS 893420-19-4) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: 4-bromo-2-chloro-N,N-dimethylbenzamide. InChIKey: HSQMINPBVRQTMK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | 4-bromo-2-chloro-N,N-dimethylbenzamide |
| InChIKey | HSQMINPBVRQTMK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)