CAS 1342639-11-5 is the registry number for N-Ethyl 4-bromo-2-chlorobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
4-bromo-2-chloro-N-ethylbenzamide (CAS 1342639-11-5) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: 4-bromo-2-chloro-N-ethylbenzamide. InChIKey: GOYYSIRRJLCYSN-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | 4-bromo-2-chloro-N-ethylbenzamide |
| InChIKey | GOYYSIRRJLCYSN-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)