Products 1607828-43-2
CAS 1607828-43-2 is the registry number for N-(4-Bromo-5-chloro-2-methylphenyl)acetamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
N-(4-bromo-5-chloro-2-methylphenyl)acetamide (CAS 1607828-43-2) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: N-(4-bromo-5-chloro-2-methylphenyl)acetamide. InChIKey: YZJNWRQUPJHEED-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | N-(4-bromo-5-chloro-2-methylphenyl)acetamide |
| InChIKey | YZJNWRQUPJHEED-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C)Cl)Br |
Computed by PubChem (NCBI)