Products 746608-45-7
CAS 746608-45-7 appears in our catalog under these names: N-(3-Bromo-4-methylphenyl)-2-chloroacetamide, 95%, N-(3-Bromo-4-methylphenyl)-2-chloroacetamide 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
N-(3-bromo-4-methylphenyl)-2-chloroacetamide (CAS 746608-45-7) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: N-(3-bromo-4-methylphenyl)-2-chloroacetamide. InChIKey: QRGBHDFCJNDFIY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | N-(3-bromo-4-methylphenyl)-2-chloroacetamide |
| InChIKey | QRGBHDFCJNDFIY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)CCl)Br |
Computed by PubChem (NCBI)