CAS 77112-27-7 appears in our catalog under these names: 2-Bromo-n-(3-chlorophenyl)propanamide, 95%, 2-Bromo-N-(3-chlorophenyl)propanamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-N-(3-chlorophenyl)propanamide (CAS 77112-27-7) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: 2-bromo-N-(3-chlorophenyl)propanamide. InChIKey: AQCUZZDNJGESDZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | 2-bromo-N-(3-chlorophenyl)propanamide |
| InChIKey | AQCUZZDNJGESDZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC(=CC=C1)Cl)Br |
Computed by PubChem (NCBI)