Products 701258-20-0
CAS 701258-20-0 appears in our catalog under these names: N,N-Dimethyl 5-bromo-2-chlorobenzamide, 98%, 5-Bromo-2-chloro-N,N-dimethylbenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
5-bromo-2-chloro-N,N-dimethylbenzamide (CAS 701258-20-0) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: 5-bromo-2-chloro-N,N-dimethylbenzamide. InChIKey: NUCDBHWIROOWTR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | 5-bromo-2-chloro-N,N-dimethylbenzamide |
| InChIKey | NUCDBHWIROOWTR-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)