cas: 194804-92-7 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-3-methoxybenzoic acid, 98% (CAS 194804-92-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | CA-5573-1g |
| cas | 194804-92-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1320.39 Pln | |
| Fluorochem | 10g | 2262.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-bromo-2-fluoro-3-methoxybenzoic acid (CAS 194804-92-7) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 4-bromo-2-fluoro-3-methoxybenzoic acid. InChIKey: FJOKKTOXWITJGO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-methoxybenzoic acid |
| InChIKey | FJOKKTOXWITJGO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)C(=O)O)Br |
Computed by PubChem (NCBI)