4-Bromo-2-methoxy-6-methylbenzoic acid, 95%
cas: 877149-08-1 — see every product listed under this CAS number, including other names
4-Bromo-2-methoxy-6-methylbenzoic acid, 95% (CAS 877149-08-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A144591-50mg |
| cas | 877149-08-1 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 398.19 Pln | |
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1844.44 Pln | |
| Ambeed | 5g | 6377.88 Pln | |
| Chemat | 50mg | 299.60 Pln | |
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1350.80 Pln | |
| Chemat | 5g | 4643.60 Pln | |
| Chemat | 10g | 8056.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-bromo-2-methoxy-6-methylbenzoic acid (CAS 877149-08-1) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 4-bromo-2-methoxy-6-methylbenzoic acid. InChIKey: RLDCUIJIUVPBBV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 4-bromo-2-methoxy-6-methylbenzoic acid |
| InChIKey | RLDCUIJIUVPBBV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)OC)Br |
Computed by PubChem (NCBI)