CAS 877149-08-1 appears in our catalog under these names: 4-Bromo-2-methoxy-6-methylbenzoic acid, 98%, 4–Bromo–2–methoxy–6–methylbenzoic acid, 4-Bromo-2-methoxy-6-methylbenzoic acid, 95%, 95%, 4-Bromo-2-methoxy-6-methylbenzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg, 50mg.
4-bromo-2-methoxy-6-methylbenzoic acid (CAS 877149-08-1) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 4-bromo-2-methoxy-6-methylbenzoic acid. InChIKey: RLDCUIJIUVPBBV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 4-bromo-2-methoxy-6-methylbenzoic acid |
| InChIKey | RLDCUIJIUVPBBV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)OC)Br |
Computed by PubChem (NCBI)