cas: 1706749-51-0 — see every product listed under this CAS number, including other names
4-Bromo-2-methyl-2,7-naphthyridin-1(2H)-one, 97% (CAS 1706749-51-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F693593-250MG |
| cas | 1706749-51-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 5g | 2939.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-methyl-2,7-naphthyridin-1-one (CAS 1706749-51-0) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 4-bromo-2-methyl-2,7-naphthyridin-1-one. InChIKey: RSRQPUNBPIDFFJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 4-bromo-2-methyl-2,7-naphthyridin-1-one |
| InChIKey | RSRQPUNBPIDFFJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)C=NC=C2)Br |
Computed by PubChem (NCBI)