cas: 98420-98-5 — see every product listed under this CAS number, including other names
4-Bromo-2-phenylpyridine 95% (CAS 98420-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A803996-100mg |
| cas | 98420-98-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 960.00 Pln | |
| Ambeed | 5g | 3630.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A803996 |
4-bromo-2-phenylpyridine (CAS 98420-98-5) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 4-bromo-2-phenylpyridine. InChIKey: HCQHVQSQHXZRGA-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 4-bromo-2-phenylpyridine |
| InChIKey | HCQHVQSQHXZRGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CC(=C2)Br |
Computed by PubChem (NCBI)