4-Bromo-3,7-dichloro-1H-indazole, 95%
cas: 2168934-16-3 — see every product listed under this CAS number, including other names
4-Bromo-3,7-dichloro-1H-indazole, 95% (CAS 2168934-16-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A665062-250mg |
| cas | 2168934-16-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 717.20 Pln | |
| Chemat | 5g | 2584.40 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 891.93 Pln | |
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 851.80 Pln | |
| Fluorochem | 5g | 3960.08 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-bromo-3,7-dichloro-2H-indazole (CAS 2168934-16-3) is a chemical compound with the molecular formula C7H3BrCl2N2 and a molecular weight of 265.92 g/mol. IUPAC name: 4-bromo-3,7-dichloro-2H-indazole. InChIKey: RVABGVLATFBNPE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2N2 |
|---|---|
| Molecular weight | 265.92 g/mol |
| IUPAC name | 4-bromo-3,7-dichloro-2H-indazole |
| InChIKey | RVABGVLATFBNPE-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NNC(=C2C(=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)