Products 1388031-84-2
CAS 1388031-84-2 is the registry number for 2-bromo-4,7-dichloro-1H-benzimidazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-bromo-4,7-dichloro-1H-benzimidazole (CAS 1388031-84-2) is a chemical compound with the molecular formula C7H3BrCl2N2 and a molecular weight of 265.92 g/mol. IUPAC name: 2-bromo-4,7-dichloro-1H-benzimidazole. InChIKey: BNLVFOLOEVRHPX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2N2 |
|---|---|
| Molecular weight | 265.92 g/mol |
| IUPAC name | 2-bromo-4,7-dichloro-1H-benzimidazole |
| InChIKey | BNLVFOLOEVRHPX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)NC(=N2)Br)Cl |
Computed by PubChem (NCBI)