Products 2092716-47-5
CAS 2092716-47-5 appears in our catalog under these names: 3-Bromo-4,6-dichloro-1H-pyrrolo[2,3-b]pyridine, 97%, 97%, 3-BROMO-4,6-DICHLORO-1H-PYRROLO[2,3-B]PYRIDINE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-bromo-4,6-dichloro-1H-pyrrolo[2,3-b]pyridine (CAS 2092716-47-5) is a chemical compound with the molecular formula C7H3BrCl2N2 and a molecular weight of 265.92 g/mol. IUPAC name: 3-bromo-4,6-dichloro-1H-pyrrolo[2,3-b]pyridine. InChIKey: SSEQKPPPRBJVLO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2N2 |
|---|---|
| Molecular weight | 265.92 g/mol |
| IUPAC name | 3-bromo-4,6-dichloro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | SSEQKPPPRBJVLO-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(NC=C2Br)N=C1Cl)Cl |
Computed by PubChem (NCBI)