CAS 2613385-27-4 is the registry number for 7-Bromo-5,6-dichloro-1H-benzo(d)imidazole, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4-bromo-5,6-dichloro-1H-benzimidazole (CAS 2613385-27-4) is a chemical compound with the molecular formula C7H3BrCl2N2 and a molecular weight of 265.92 g/mol. IUPAC name: 4-bromo-5,6-dichloro-1H-benzimidazole. InChIKey: MPHNFGWDXVYTJQ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2N2 |
|---|---|
| Molecular weight | 265.92 g/mol |
| IUPAC name | 4-bromo-5,6-dichloro-1H-benzimidazole |
| InChIKey | MPHNFGWDXVYTJQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1Cl)Cl)Br)N=CN2 |
Computed by PubChem (NCBI)