Products 2168934-16-3
CAS 2168934-16-3 appears in our catalog under these names: 4–Bromo–3，7–dichloro–1H–indazole, 4-Bromo-3,7-dichloro-1H-indazole, 95%, 95%, 4-Bromo-3,7-dichloro-1H-indazole, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bromo-3,7-dichloro-2H-indazole (CAS 2168934-16-3) is a chemical compound with the molecular formula C7H3BrCl2N2 and a molecular weight of 265.92 g/mol. IUPAC name: 4-bromo-3,7-dichloro-2H-indazole. InChIKey: RVABGVLATFBNPE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2N2 |
|---|---|
| Molecular weight | 265.92 g/mol |
| IUPAC name | 4-bromo-3,7-dichloro-2H-indazole |
| InChIKey | RVABGVLATFBNPE-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NNC(=C2C(=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)