Products 2768276-31-7
CAS 2768276-31-7 is the registry number for 7-Bromo-2,4-dichloropyrrolo[1,2-a]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2,4-dichloropyrrolo[1,2-a]pyrimidine (CAS 2768276-31-7) is a chemical compound with the molecular formula C7H3BrCl2N2 and a molecular weight of 265.92 g/mol. IUPAC name: 7-bromo-2,4-dichloropyrrolo[1,2-a]pyrimidine. InChIKey: IKHBCTMNXJQWMT-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2N2 |
|---|---|
| Molecular weight | 265.92 g/mol |
| IUPAC name | 7-bromo-2,4-dichloropyrrolo[1,2-a]pyrimidine |
| InChIKey | IKHBCTMNXJQWMT-UHFFFAOYSA-N |
| SMILES | C1=C2N=C(C=C(N2C=C1Br)Cl)Cl |
Computed by PubChem (NCBI)