4-Bromo-3-fluorobenzenesulphonamide, 98%
cas: 263349-73-1 — see every product listed under this CAS number, including other names
4-Bromo-3-fluorobenzenesulphonamide, 98% (CAS 263349-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A261205-1g |
| cas | 263349-73-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 25g | 442.69 Pln | |
| Ambeed | 100g | 1527.38 Pln | |
| Ambeed | 500g | 6845.12 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 198.80 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 25g | 469.86 Pln | |
| BLDpharm | 100g | 1641.67 Pln | |
| BLDpharm | 500g | 7372.98 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-bromo-3-fluorobenzenesulfonamide (CAS 263349-73-1) is a chemical compound with the molecular formula C6H5BrFNO2S and a molecular weight of 254.08 g/mol. IUPAC name: 4-bromo-3-fluorobenzenesulfonamide. InChIKey: QTICZSSQSQDJEX-UHFFFAOYSA-N.
| Molecular formula | C6H5BrFNO2S |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-bromo-3-fluorobenzenesulfonamide |
| InChIKey | QTICZSSQSQDJEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)F)Br |
Computed by PubChem (NCBI)