Products 2408741-12-6
CAS 2408741-12-6 is the registry number for 3-Bromo-2-fluoro-5-(methylsulfonyl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2-fluoro-5-methylsulfonylpyridine (CAS 2408741-12-6) is a chemical compound with the molecular formula C6H5BrFNO2S and a molecular weight of 254.08 g/mol. IUPAC name: 3-bromo-2-fluoro-5-methylsulfonylpyridine. InChIKey: MNMYEGCYVLWPNS-UHFFFAOYSA-N.
| Molecular formula | C6H5BrFNO2S |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 3-bromo-2-fluoro-5-methylsulfonylpyridine |
| InChIKey | MNMYEGCYVLWPNS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(N=C1)F)Br |
Computed by PubChem (NCBI)