CAS 351003-60-6 appears in our catalog under these names: 2-Bromo-4-fluorobenzenesulfonamide, 95%, 2-Bromo-4-fluorobenzenesulfonamide, 95+%, 2-Bromo-4-fluorobenzenesulfonamide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 25g.
2-bromo-4-fluorobenzenesulfonamide (CAS 351003-60-6) is a chemical compound with the molecular formula C6H5BrFNO2S and a molecular weight of 254.08 g/mol. IUPAC name: 2-bromo-4-fluorobenzenesulfonamide. InChIKey: FEUDPWHDKUOLBW-UHFFFAOYSA-N.
| Molecular formula | C6H5BrFNO2S |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-bromo-4-fluorobenzenesulfonamide |
| InChIKey | FEUDPWHDKUOLBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)