CAS 1843194-48-8 is the registry number for 3-Bromo-5-fluorobenzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-5-fluorobenzenesulfonamide (CAS 1843194-48-8) is a chemical compound with the molecular formula C6H5BrFNO2S and a molecular weight of 254.08 g/mol. IUPAC name: 3-bromo-5-fluorobenzenesulfonamide. InChIKey: QWTUMPLHIHZLAE-UHFFFAOYSA-N.
| Molecular formula | C6H5BrFNO2S |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 3-bromo-5-fluorobenzenesulfonamide |
| InChIKey | QWTUMPLHIHZLAE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)N)Br)F |
Computed by PubChem (NCBI)