Products 108045-28-9
CAS 108045-28-9 is the registry number for 4-Amino-3-bromobenzene-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-3-bromobenzenesulfonyl fluoride (CAS 108045-28-9) is a chemical compound with the molecular formula C6H5BrFNO2S and a molecular weight of 254.08 g/mol. IUPAC name: 4-amino-3-bromobenzenesulfonyl fluoride. InChIKey: UZACAJVHSLWABY-UHFFFAOYSA-N.
| Molecular formula | C6H5BrFNO2S |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-amino-3-bromobenzenesulfonyl fluoride |
| InChIKey | UZACAJVHSLWABY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)F)Br)N |
Computed by PubChem (NCBI)