CAS 214210-30-7 appears in our catalog under these names: 4-Bromo-2-fluorobenzenesulfonamide, 95%, 4-Bromo-2-fluorobenzenesulfonamide, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 100g, 1g, 5g, 250mg, 10g.
4-bromo-2-fluorobenzenesulfonamide (CAS 214210-30-7) is a chemical compound with the molecular formula C6H5BrFNO2S and a molecular weight of 254.08 g/mol. IUPAC name: 4-bromo-2-fluorobenzenesulfonamide. InChIKey: ZCPVDHZKGQQHDS-UHFFFAOYSA-N.
| Molecular formula | C6H5BrFNO2S |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-bromo-2-fluorobenzenesulfonamide |
| InChIKey | ZCPVDHZKGQQHDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)S(=O)(=O)N |
Computed by PubChem (NCBI)