cas: 78137-76-5 — see every product listed under this CAS number, including other names
4-Bromo-3-nitrophenol 97% (CAS 78137-76-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A135778-1g |
| cas | 78137-76-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 286.94 Pln | |
| Ambeed | 100g | 921.06 Pln | |
| Ambeed | 500g | 3351.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A135778 |
4-bromo-3-nitrophenol (CAS 78137-76-5) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 4-bromo-3-nitrophenol. InChIKey: MTNZLOXGKDQNKA-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 4-bromo-3-nitrophenol |
| InChIKey | MTNZLOXGKDQNKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)