cas: 58743-79-6 — see every product listed under this CAS number, including other names
4-Bromo-4'-ethyl-1,1'-biphenyl, 98%, 98% (CAS 58743-79-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EB7P-1g |
| cas | 58743-79-6 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 100g | 597.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-(4-ethylphenyl)benzene (CAS 58743-79-6) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 1-bromo-4-(4-ethylphenyl)benzene. InChIKey: OARBGVNQCYYPKT-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 1-bromo-4-(4-ethylphenyl)benzene |
| InChIKey | OARBGVNQCYYPKT-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)