cas: 1889089-88-6 — see every product listed under this CAS number, including other names
4-Bromo-6-chloroindolin-2-one 97% (CAS 1889089-88-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A540310-100mg |
| cas | 1889089-88-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1054.56 Pln | |
| Ambeed | 250mg | 1733.19 Pln | |
| Ambeed | 1g | 4553.38 Pln | |
| Ambeed | 5g | 17336.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A540310 |
4-bromo-6-chloro-1,3-dihydroindol-2-one (CAS 1889089-88-6) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 4-bromo-6-chloro-1,3-dihydroindol-2-one. InChIKey: MXNURYKCRIDPNM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 4-bromo-6-chloro-1,3-dihydroindol-2-one |
| InChIKey | MXNURYKCRIDPNM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2Br)Cl)NC1=O |
Computed by PubChem (NCBI)