CAS 1889089-88-6 appears in our catalog under these names: 4-Bromo-6-chloroindolin-2-one 97%, 4-Bromo-6-chloro-1,3-dihydroindol-2-one, 98%, 4-Bromo-6-chloroindolin-2-one, 97%, 97%. Offered by: Ambeed, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bromo-6-chloro-1,3-dihydroindol-2-one (CAS 1889089-88-6) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 4-bromo-6-chloro-1,3-dihydroindol-2-one. InChIKey: MXNURYKCRIDPNM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 4-bromo-6-chloro-1,3-dihydroindol-2-one |
| InChIKey | MXNURYKCRIDPNM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2Br)Cl)NC1=O |
Computed by PubChem (NCBI)