CAS 1699598-91-8 appears in our catalog under these names: 6-Bromo-5-chloro-2,3-dihydro-1h-indol-2-one, 95%, 6-Bromo-5-chloroindolin-2-one, 97%, 6-bromo-5-chloro-2,3-dihydro-1H-indol-2-one, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg, 500mg.
6-bromo-5-chloro-1,3-dihydroindol-2-one (CAS 1699598-91-8) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 6-bromo-5-chloro-1,3-dihydroindol-2-one. InChIKey: RJWNCPKNANWIGI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 6-bromo-5-chloro-1,3-dihydroindol-2-one |
| InChIKey | RJWNCPKNANWIGI-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Br)Cl |
Computed by PubChem (NCBI)