Products 1186310-94-0
CAS 1186310-94-0 is the registry number for 6-Bromo-2-(chloromethyl)furo[3,2-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
6-bromo-2-(chloromethyl)furo[3,2-b]pyridine (CAS 1186310-94-0) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 6-bromo-2-(chloromethyl)furo[3,2-b]pyridine. InChIKey: URCGPXXHAADRJJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 6-bromo-2-(chloromethyl)furo[3,2-b]pyridine |
| InChIKey | URCGPXXHAADRJJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1OC(=C2)CCl)Br |
Computed by PubChem (NCBI)