cas: 1889089-88-6 — see every product listed under this CAS number, including other names
4-Bromo-6-chloroindolin-2-one, 97%, 97% (CAS 1889089-88-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I3RL-100mg |
| cas | 1889089-88-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 856.40 Pln | |
| Chemat | 250mg | 1418.00 Pln | |
| Chemat | 1g | 3717.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-6-chloro-1,3-dihydroindol-2-one (CAS 1889089-88-6) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 4-bromo-6-chloro-1,3-dihydroindol-2-one. InChIKey: MXNURYKCRIDPNM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 4-bromo-6-chloro-1,3-dihydroindol-2-one |
| InChIKey | MXNURYKCRIDPNM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2Br)Cl)NC1=O |
Computed by PubChem (NCBI)