CAS 944903-23-5 appears in our catalog under these names: 6-Bromo-2-(chloromethyl)-1,3-benzoxazole, 95%, 6-Bromo-2-(chloromethyl)-1,3-benzoxazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.
6-bromo-2-(chloromethyl)-1,3-benzoxazole (CAS 944903-23-5) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 6-bromo-2-(chloromethyl)-1,3-benzoxazole. InChIKey: RLVYPVDIOCNSDL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 6-bromo-2-(chloromethyl)-1,3-benzoxazole |
| InChIKey | RLVYPVDIOCNSDL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(=N2)CCl |
Computed by PubChem (NCBI)