cas: 81945-13-3 — see every product listed under this CAS number, including other names
4-Bromo-7-hydroxy-2,3-dihydro-1H-inden-1-one 95% (CAS 81945-13-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139299-100g |
| cas | 81945-13-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 13881.69 Pln | |
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 932.19 Pln | |
| Ambeed | 25g | 4386.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A139299 |
4-bromo-7-hydroxy-2,3-dihydroinden-1-one (CAS 81945-13-3) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 4-bromo-7-hydroxy-2,3-dihydroinden-1-one. InChIKey: ZTWBCFVYMDBPPD-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 4-bromo-7-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | ZTWBCFVYMDBPPD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)Br)O |
Computed by PubChem (NCBI)