cas: 50885-29-5 — see every product listed under this CAS number, including other names
4-Bromo-n-(2,2,2-trifluoroethyl)aniline, 95%, 95% (CAS 50885-29-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120XYL-250mg |
| cas | 50885-29-5 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1058.00 Pln | |
| Chemat | 5g | 2037.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-N-(2,2,2-trifluoroethyl)aniline (CAS 50885-29-5) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: 4-bromo-N-(2,2,2-trifluoroethyl)aniline. InChIKey: JHMCLUDNRSGKDA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | 4-bromo-N-(2,2,2-trifluoroethyl)aniline |
| InChIKey | JHMCLUDNRSGKDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NCC(F)(F)F)Br |
Computed by PubChem (NCBI)