CAS 473537-92-7 is the registry number for Ethyl 4-(3-bromophenyl)-2,4-dioxobutanoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 4-(3-bromophenyl)-2,4-dioxobutanoate (CAS 473537-92-7) is a chemical compound with the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. IUPAC name: ethyl 4-(3-bromophenyl)-2,4-dioxobutanoate. InChIKey: KEHJWELPDWMNRB-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO4 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | ethyl 4-(3-bromophenyl)-2,4-dioxobutanoate |
| InChIKey | KEHJWELPDWMNRB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)